About methyl 10-oxobicyclo[4.3.1]deca-2,4,7-triene-8-carboxylate
methyl 10-oxobicyclo[4.3.1]deca-2,4,7-triene-8-carboxylate (PubChem CID 86053832) has the molecular formula C12H12O3
and a molecular weight of 204.22 g/mol. Its IUPAC name is methyl 10-oxobicyclo[4.3.1]deca-2,4,7-triene-8-carboxylate.
Analyze methyl 10-oxobicyclo[4.3.1]deca-2,4,7-triene-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 10-oxobicyclo[4.3.1]deca-2,4,7-triene-8-carboxylate?
The IUPAC name of methyl 10-oxobicyclo[4.3.1]deca-2,4,7-triene-8-carboxylate (CID 86053832) is methyl 10-oxobicyclo[4.3.1]deca-2,4,7-triene-8-carboxylate.
What is the SMILES notation for methyl 10-oxobicyclo[4.3.1]deca-2,4,7-triene-8-carboxylate?
The canonical SMILES for methyl 10-oxobicyclo[4.3.1]deca-2,4,7-triene-8-carboxylate is COC(=O)C1=CC2C=CC=CC(C1)C2=O.
What is the InChIKey of methyl 10-oxobicyclo[4.3.1]deca-2,4,7-triene-8-carboxylate?
The InChIKey is STEUHJNZEJIZNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O3/c1-15-12(14)10-6-8-4-2-3-5-9(7-10)11(8)13/h2-6,8-9H,7H2,1H3.
What are the key properties of methyl 10-oxobicyclo[4.3.1]deca-2,4,7-triene-8-carboxylate?
methyl 10-oxobicyclo[4.3.1]deca-2,4,7-triene-8-carboxylate has a molecular weight of 204.22 g/mol, XLogP of 1.42, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 10-oxobicyclo[4.3.1]deca-2,4,7-triene-8-carboxylate is sourced from PubChem (CID 86053832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).