C12H18ClNO4 — CID 146177845
methyl (3S,4S)-3-chloro-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentene-1-carboxylate (PubChem CID 146177845) has the molecular formula C12H18ClNO4 and a molecular weight of 275.73 g/mol. Its IUPAC name is methyl (3S,4S)-3-chloro-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentene-1-carboxylate.
| Compound Name | methyl (3S,4S)-3-chloro-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentene-1-carboxylate |
|---|---|
| PubChem CID | 146177845 |
| Molecular Formula | C12H18ClNO4 |
| Molecular Weight | 275.73 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | methyl (3S,4S)-3-chloro-4-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentene-1-carboxylate |
| SMILES | COC(=O)C1=C[C@H](Cl)[C@@H](NC(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C12H18ClNO4/c1-12(2,3)18-11(16)14-9-6-7(5-8(9)13)10(15)17-4/h5,8-9H,6H2,1-4H3,(H,14,16)/t8-,9-/m0/s1 |
| InChIKey | ZCPYABOBQVKAIX-IUCAKERBSA-N |
| XLogP | 1.99 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.73 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|