C13H20N4O6 — CID 20651740
methyl 4-acetamido-3-azido-5-(2,3-dihydroxypropoxy)cyclohexene-1-carboxylate (PubChem CID 20651740) has the molecular formula C13H20N4O6 and a molecular weight of 328.33 g/mol. Its IUPAC name is methyl 4-acetamido-3-azido-5-(2,3-dihydroxypropoxy)cyclohexene-1-carboxylate.
| Compound Name | methyl 4-acetamido-3-azido-5-(2,3-dihydroxypropoxy)cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 20651740 |
| Molecular Formula | C13H20N4O6 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | methyl 4-acetamido-3-azido-5-(2,3-dihydroxypropoxy)cyclohexene-1-carboxylate |
| SMILES | COC(=O)C1=CC(N=[N+]=[N-])C(NC(C)=O)C(OCC(O)CO)C1 |
| InChI | InChI=1S/C13H20N4O6/c1-7(19)15-12-10(16-17-14)3-8(13(21)22-2)4-11(12)23-6-9(20)5-18/h3,9-12,18,20H,4-6H2,1-2H3,(H,15,19) |
| InChIKey | FDTZBEIEFLDABQ-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 153.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|