C17H24N4O9 — CID 11177845
methyl (2R,3R,4S)-3-acetamido-4-azido-2-[(1S,2R)-2,3-diacetyloxy-1-methoxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 11177845) has the molecular formula C17H24N4O9 and a molecular weight of 428.40 g/mol. Its IUPAC name is methyl (2R,3R,4S)-3-acetamido-4-azido-2-[(1S,2R)-2,3-diacetyloxy-1-methoxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | methyl (2R,3R,4S)-3-acetamido-4-azido-2-[(1S,2R)-2,3-diacetyloxy-1-methoxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 11177845 |
| Molecular Formula | C17H24N4O9 |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | methyl (2R,3R,4S)-3-acetamido-4-azido-2-[(1S,2R)-2,3-diacetyloxy-1-methoxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | COC(=O)C1=C[C@H](N=[N+]=[N-])[C@@H](NC(C)=O)[C@H]([C@H](OC)[C@@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C17H24N4O9/c1-8(22)19-14-11(20-21-18)6-12(17(25)27-5)30-16(14)15(26-4)13(29-10(3)24)7-28-9(2)23/h6,11,13-16H,7H2,1-5H3,(H,19,22)/t11-,13+,14+,15+,16+/m0/s1 |
| InChIKey | CXLMWSDSTYPIGN-CWCFIDOXSA-N |
| XLogP | 0.14 |
| TPSA | 175.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|