C20H28N4O11 — CID 11420639
methyl (2R,3R,4S)-3-acetamido-4-azido-2-[(1S,2R)-2,3-diacetyloxy-1-(2-acetyloxyethoxy)propyl]-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 11420639) has the molecular formula C20H28N4O11 and a molecular weight of 500.46 g/mol. Its IUPAC name is methyl (2R,3R,4S)-3-acetamido-4-azido-2-[(1S,2R)-2,3-diacetyloxy-1-(2-acetyloxyethoxy)propyl]-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | methyl (2R,3R,4S)-3-acetamido-4-azido-2-[(1S,2R)-2,3-diacetyloxy-1-(2-acetyloxyethoxy)propyl]-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 11420639 |
| Molecular Formula | C20H28N4O11 |
| Molecular Weight | 500.46 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | methyl (2R,3R,4S)-3-acetamido-4-azido-2-[(1S,2R)-2,3-diacetyloxy-1-(2-acetyloxyethoxy)propyl]-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | COC(=O)C1=C[C@H](N=[N+]=[N-])[C@@H](NC(C)=O)[C@H]([C@H](OCCOC(C)=O)[C@@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C20H28N4O11/c1-10(25)22-17-14(23-24-21)8-15(20(29)30-5)35-19(17)18(32-7-6-31-11(2)26)16(34-13(4)28)9-33-12(3)27/h8,14,16-19H,6-7,9H2,1-5H3,(H,22,25)/t14-,16+,17+,18+,19+/m0/s1 |
| InChIKey | FYDLJQARFWNEBP-AIHBUXEESA-N |
| XLogP | 0.07 |
| TPSA | 201.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.46 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|