C21H26N2O10S — CID 142059320
methyl (2R,3R,4R)-3-acetamido-4-(1,3-thiazol-2-yl)-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 142059320) has the molecular formula C21H26N2O10S and a molecular weight of 498.51 g/mol. Its IUPAC name is methyl (2R,3R,4R)-3-acetamido-4-(1,3-thiazol-2-yl)-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | methyl (2R,3R,4R)-3-acetamido-4-(1,3-thiazol-2-yl)-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 142059320 |
| Molecular Formula | C21H26N2O10S |
| Molecular Weight | 498.51 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | methyl (2R,3R,4R)-3-acetamido-4-(1,3-thiazol-2-yl)-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | COC(=O)C1=C[C@@H](c2nccs2)[C@@H](NC(C)=O)[C@H]([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C21H26N2O10S/c1-10(24)23-17-14(20-22-6-7-34-20)8-15(21(28)29-5)33-19(17)18(32-13(4)27)16(31-12(3)26)9-30-11(2)25/h6-8,14,16-19H,9H2,1-5H3,(H,23,24)/t14-,16-,17-,18-,19-/m1/s1 |
| InChIKey | ZAOWABJRCVQZFK-WSIUPNEHSA-N |
| XLogP | 0.61 |
| TPSA | 156.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.51 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|