C19H25NO11 — CID 10813124
methyl (4aR,8R,8aR)-4a-hydroxy-2-methyl-8-[(1S,2R)-1,2,3-triacetyloxypropyl]-8,8a-dihydro-4H-pyrano[3,4-d][1,3]oxazine-6-carboxylate (PubChem CID 10813124) has the molecular formula C19H25NO11 and a molecular weight of 443.41 g/mol. Its IUPAC name is methyl (4aR,8R,8aR)-4a-hydroxy-2-methyl-8-[(1S,2R)-1,2,3-triacetyloxypropyl]-8,8a-dihydro-4H-pyrano[3,4-d][1,3]oxazine-6-carboxylate.
| Compound Name | methyl (4aR,8R,8aR)-4a-hydroxy-2-methyl-8-[(1S,2R)-1,2,3-triacetyloxypropyl]-8,8a-dihydro-4H-pyrano[3,4-d][1,3]oxazine-6-carboxylate |
|---|---|
| PubChem CID | 10813124 |
| Molecular Formula | C19H25NO11 |
| Molecular Weight | 443.41 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | methyl (4aR,8R,8aR)-4a-hydroxy-2-methyl-8-[(1S,2R)-1,2,3-triacetyloxypropyl]-8,8a-dihydro-4H-pyrano[3,4-d][1,3]oxazine-6-carboxylate |
| SMILES | COC(=O)C1=C[C@]2(O)COC(C)=N[C@@H]2[C@H]([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C19H25NO11/c1-9-20-17-16(31-13(18(24)26-5)6-19(17,25)8-28-9)15(30-12(4)23)14(29-11(3)22)7-27-10(2)21/h6,14-17,25H,7-8H2,1-5H3/t14-,15-,16+,17-,19+/m1/s1 |
| InChIKey | IHVYEVCHUNQHLP-ILYVXUQDSA-N |
| XLogP | -0.58 |
| TPSA | 156.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.41 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|