C16H22N4O9 — CID 118933949
methyl (2R,3R,4S)-3-amino-4-azido-2-[(1S)-1,2,3-triacetyloxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 118933949) has the molecular formula C16H22N4O9 and a molecular weight of 414.37 g/mol. Its IUPAC name is methyl (2R,3R,4S)-3-amino-4-azido-2-[(1S)-1,2,3-triacetyloxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | methyl (2R,3R,4S)-3-amino-4-azido-2-[(1S)-1,2,3-triacetyloxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 118933949 |
| Molecular Formula | C16H22N4O9 |
| Molecular Weight | 414.37 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | methyl (2R,3R,4S)-3-amino-4-azido-2-[(1S)-1,2,3-triacetyloxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | COC(=O)C1=C[C@H](N=[N+]=[N-])[C@@H](N)[C@H]([C@H](OC(C)=O)C(COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C16H22N4O9/c1-7(21)26-6-12(27-8(2)22)14(28-9(3)23)15-13(17)10(19-20-18)5-11(29-15)16(24)25-4/h5,10,12-15H,6,17H2,1-4H3/t10-,12?,13+,14+,15+/m0/s1 |
| InChIKey | VSZSAUWTOAXVML-MHVKIQEISA-N |
| XLogP | -0.13 |
| TPSA | 189.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.37 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|