C18H25NO11 — CID 155011878
methyl (2R,3R,4S)-4-acetyloxy-3-amino-2-(1,2,3-triacetyloxypropyl)-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 155011878) has the molecular formula C18H25NO11 and a molecular weight of 431.39 g/mol. Its IUPAC name is methyl (2R,3R,4S)-4-acetyloxy-3-amino-2-(1,2,3-triacetyloxypropyl)-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | methyl (2R,3R,4S)-4-acetyloxy-3-amino-2-(1,2,3-triacetyloxypropyl)-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 155011878 |
| Molecular Formula | C18H25NO11 |
| Molecular Weight | 431.39 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | methyl (2R,3R,4S)-4-acetyloxy-3-amino-2-(1,2,3-triacetyloxypropyl)-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | COC(=O)C1=C[C@H](OC(C)=O)[C@@H](N)[C@H](C(OC(C)=O)C(COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C18H25NO11/c1-8(20)26-7-14(28-10(3)22)16(29-11(4)23)17-15(19)12(27-9(2)21)6-13(30-17)18(24)25-5/h6,12,14-17H,7,19H2,1-5H3/t12-,14?,15+,16?,17+/m0/s1 |
| InChIKey | QMASPAUDMCZAAA-DOAKTBNESA-N |
| XLogP | -0.87 |
| TPSA | 166.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.39 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|