C24H25ClF3NO11 — CID 71763960
methyl (2R,3R,4R)-4-(4-chlorophenoxy)-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-3-[(2,2,2-trifluoroacetyl)amino]-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 71763960) has the molecular formula C24H25ClF3NO11 and a molecular weight of 595.91 g/mol. Its IUPAC name is methyl (2R,3R,4R)-4-(4-chlorophenoxy)-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-3-[(2,2,2-trifluoroacetyl)amino]-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | methyl (2R,3R,4R)-4-(4-chlorophenoxy)-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-3-[(2,2,2-trifluoroacetyl)amino]-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 71763960 |
| Molecular Formula | C24H25ClF3NO11 |
| Molecular Weight | 595.91 g/mol |
| Exact Mass | 595.11 |
| IUPAC Name | methyl (2R,3R,4R)-4-(4-chlorophenoxy)-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-3-[(2,2,2-trifluoroacetyl)amino]-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | COC(=O)C1=C[C@@H](Oc2ccc(Cl)cc2)[C@@H](NC(=O)C(F)(F)F)[C@H]([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C24H25ClF3NO11/c1-11(30)36-10-18(37-12(2)31)20(38-13(3)32)21-19(29-23(34)24(26,27)28)16(9-17(40-21)22(33)35-4)39-15-7-5-14(25)6-8-15/h5-9,16,18-21H,10H2,1-4H3,(H,29,34)/t16-,18-,19-,20-,21-/m1/s1 |
| InChIKey | YQORPCDYHWGFCR-GHRYLNIYSA-N |
| XLogP | 2.02 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.91 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|