C20H28N2O13S — CID 11847874
methyl (2R)-3-acetamido-2-(1-acetyloxy-2,3-dicarboxyoxypropyl)-4-(4-amino-4-sulfanylidenebutoxy)-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 11847874) has the molecular formula C20H28N2O13S and a molecular weight of 536.51 g/mol. Its IUPAC name is methyl (2R)-3-acetamido-2-(1-acetyloxy-2,3-dicarboxyoxypropyl)-4-(4-amino-4-sulfanylidenebutoxy)-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | methyl (2R)-3-acetamido-2-(1-acetyloxy-2,3-dicarboxyoxypropyl)-4-(4-amino-4-sulfanylidenebutoxy)-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 11847874 |
| Molecular Formula | C20H28N2O13S |
| Molecular Weight | 536.51 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | methyl (2R)-3-acetamido-2-(1-acetyloxy-2,3-dicarboxyoxypropyl)-4-(4-amino-4-sulfanylidenebutoxy)-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | COC(=O)C1=CC(OCCCC(N)=S)C(NC(C)=O)[C@H](C(OC(C)=O)C(COC(=O)O)OC(=O)O)O1 |
| InChI | InChI=1S/C20H28N2O13S/c1-9(23)22-15-11(31-6-4-5-14(21)36)7-12(18(25)30-3)34-17(15)16(33-10(2)24)13(35-20(28)29)8-32-19(26)27/h7,11,13,15-17H,4-6,8H2,1-3H3,(H2,21,36)(H,22,23)(H,26,27)(H,28,29)/t11?,13?,15?,16?,17-/m1/s1 |
| InChIKey | IQQCVMKXROSREP-XYXXWMMVSA-N |
| XLogP | 0.09 |
| TPSA | 219.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.51 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|