C25H37N3O12 — CID 102450267
methyl (2S,3R,4S)-3-acetamido-4-[2-[acetyl(methyl)amino]butanoylamino]-2-[(1R,2R)-1,2,3-triacetyloxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 102450267) has the molecular formula C25H37N3O12 and a molecular weight of 571.58 g/mol. Its IUPAC name is methyl (2S,3R,4S)-3-acetamido-4-[2-[acetyl(methyl)amino]butanoylamino]-2-[(1R,2R)-1,2,3-triacetyloxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | methyl (2S,3R,4S)-3-acetamido-4-[2-[acetyl(methyl)amino]butanoylamino]-2-[(1R,2R)-1,2,3-triacetyloxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 102450267 |
| Molecular Formula | C25H37N3O12 |
| Molecular Weight | 571.58 g/mol |
| Exact Mass | 571.24 |
| IUPAC Name | methyl (2S,3R,4S)-3-acetamido-4-[2-[acetyl(methyl)amino]butanoylamino]-2-[(1R,2R)-1,2,3-triacetyloxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | CCC(C(=O)N[C@H]1C=C(C(=O)OC)O[C@H]([C@@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)[C@@H]1NC(C)=O)N(C)C(C)=O |
| InChI | InChI=1S/C25H37N3O12/c1-9-18(28(7)13(3)30)24(34)27-17-10-19(25(35)36-8)40-23(21(17)26-12(2)29)22(39-16(6)33)20(38-15(5)32)11-37-14(4)31/h10,17-18,20-23H,9,11H2,1-8H3,(H,26,29)(H,27,34)/t17-,18?,20+,21+,22-,23-/m0/s1 |
| InChIKey | JFUANPCPSSSWCZ-MBRCOMHPSA-N |
| XLogP | -0.88 |
| TPSA | 192.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.58 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|