C18H23NO11 — CID 101018603
methyl (2R,3S)-3-acetamido-4-oxo-2-[(1S,2S)-1,2,3-triacetyloxypropyl]-2,3-dihydropyran-6-carboxylate (PubChem CID 101018603) has the molecular formula C18H23NO11 and a molecular weight of 429.38 g/mol. Its IUPAC name is methyl (2R,3S)-3-acetamido-4-oxo-2-[(1S,2S)-1,2,3-triacetyloxypropyl]-2,3-dihydropyran-6-carboxylate.
| Compound Name | methyl (2R,3S)-3-acetamido-4-oxo-2-[(1S,2S)-1,2,3-triacetyloxypropyl]-2,3-dihydropyran-6-carboxylate |
|---|---|
| PubChem CID | 101018603 |
| Molecular Formula | C18H23NO11 |
| Molecular Weight | 429.38 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | methyl (2R,3S)-3-acetamido-4-oxo-2-[(1S,2S)-1,2,3-triacetyloxypropyl]-2,3-dihydropyran-6-carboxylate |
| SMILES | COC(=O)C1=CC(=O)[C@@H](NC(C)=O)[C@H]([C@H](OC(C)=O)[C@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C18H23NO11/c1-8(20)19-15-12(24)6-13(18(25)26-5)30-17(15)16(29-11(4)23)14(28-10(3)22)7-27-9(2)21/h6,14-17H,7H2,1-5H3,(H,19,20)/t14-,15+,16+,17+/m0/s1 |
| InChIKey | MRLYJEFSKHXVCZ-YLFCFFPRSA-N |
| XLogP | -1.06 |
| TPSA | 160.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.38 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|