C20H24F3NO12 — CID 102127678
methyl (2R,3R,4S)-4-acetyloxy-5-deuterio-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-3-[(2,2,2-trifluoroacetyl)amino]-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 102127678) has the molecular formula C20H24F3NO12 and a molecular weight of 528.41 g/mol. Its IUPAC name is methyl (2R,3R,4S)-4-acetyloxy-5-deuterio-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-3-[(2,2,2-trifluoroacetyl)amino]-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | methyl (2R,3R,4S)-4-acetyloxy-5-deuterio-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-3-[(2,2,2-trifluoroacetyl)amino]-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 102127678 |
| Molecular Formula | C20H24F3NO12 |
| Molecular Weight | 528.41 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | methyl (2R,3R,4S)-4-acetyloxy-5-deuterio-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-3-[(2,2,2-trifluoroacetyl)amino]-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | [2H]C1=C(C(=O)OC)O[C@@H]([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)[C@H](NC(=O)C(F)(F)F)[C@H]1OC(C)=O |
| InChI | InChI=1S/C20H24F3NO12/c1-8(25)32-7-14(34-10(3)27)16(35-11(4)28)17-15(24-19(30)20(21,22)23)12(33-9(2)26)6-13(36-17)18(29)31-5/h6,12,14-17H,7H2,1-5H3,(H,24,30)/t12-,14+,15+,16+,17+/m0/s1/i6D |
| InChIKey | LVQOZYCUZNIYQU-BXGIBAOMSA-N |
| XLogP | -0.15 |
| TPSA | 169.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.41 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|