C22H24F7NO12 — CID 102048336
methyl (2R,3R,4S)-4-acetyloxy-3-amino-3-(2,2,3,3,4,4,4-heptafluorobutanoyl)-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-2,4-dihydropyran-6-carboxylate (PubChem CID 102048336) has the molecular formula C22H24F7NO12 and a molecular weight of 627.42 g/mol. Its IUPAC name is methyl (2R,3R,4S)-4-acetyloxy-3-amino-3-(2,2,3,3,4,4,4-heptafluorobutanoyl)-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-2,4-dihydropyran-6-carboxylate.
| Compound Name | methyl (2R,3R,4S)-4-acetyloxy-3-amino-3-(2,2,3,3,4,4,4-heptafluorobutanoyl)-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-2,4-dihydropyran-6-carboxylate |
|---|---|
| PubChem CID | 102048336 |
| Molecular Formula | C22H24F7NO12 |
| Molecular Weight | 627.42 g/mol |
| Exact Mass | 627.12 |
| IUPAC Name | methyl (2R,3R,4S)-4-acetyloxy-3-amino-3-(2,2,3,3,4,4,4-heptafluorobutanoyl)-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-2,4-dihydropyran-6-carboxylate |
| SMILES | COC(=O)C1=C[C@H](OC(C)=O)[C@](N)(C(=O)C(F)(F)C(F)(F)C(F)(F)F)[C@H]([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C22H24F7NO12/c1-8(31)38-7-13(39-9(2)32)15(41-11(4)34)16-19(30,18(36)20(23,24)21(25,26)22(27,28)29)14(40-10(3)33)6-12(42-16)17(35)37-5/h6,13-16H,7,30H2,1-5H3/t13-,14+,15-,16+,19-/m1/s1 |
| InChIKey | YVIBGAKKOICDKF-NTODXPRQSA-N |
| XLogP | 0.90 |
| TPSA | 183.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.42 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|