C20H26F3NO13 — CID 10745135
methyl (2S,4S,5R,6R)-4-acetyloxy-2-hydroxy-6-[(1S,2R)-1,2,3-triacetyloxypropyl]-5-[(2,2,2-trifluoroacetyl)amino]oxane-2-carboxylate (PubChem CID 10745135) has the molecular formula C20H26F3NO13 and a molecular weight of 545.42 g/mol. Its IUPAC name is methyl (2S,4S,5R,6R)-4-acetyloxy-2-hydroxy-6-[(1S,2R)-1,2,3-triacetyloxypropyl]-5-[(2,2,2-trifluoroacetyl)amino]oxane-2-carboxylate.
| Compound Name | methyl (2S,4S,5R,6R)-4-acetyloxy-2-hydroxy-6-[(1S,2R)-1,2,3-triacetyloxypropyl]-5-[(2,2,2-trifluoroacetyl)amino]oxane-2-carboxylate |
|---|---|
| PubChem CID | 10745135 |
| Molecular Formula | C20H26F3NO13 |
| Molecular Weight | 545.42 g/mol |
| Exact Mass | 545.14 |
| IUPAC Name | methyl (2S,4S,5R,6R)-4-acetyloxy-2-hydroxy-6-[(1S,2R)-1,2,3-triacetyloxypropyl]-5-[(2,2,2-trifluoroacetyl)amino]oxane-2-carboxylate |
| SMILES | COC(=O)[C@]1(O)C[C@H](OC(C)=O)[C@@H](NC(=O)C(F)(F)F)[C@H]([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C20H26F3NO13/c1-8(25)33-7-13(35-10(3)27)15(36-11(4)28)16-14(24-17(29)20(21,22)23)12(34-9(2)26)6-19(31,37-16)18(30)32-5/h12-16,31H,6-7H2,1-5H3,(H,24,29)/t12-,13+,14+,15+,16+,19-/m0/s1 |
| InChIKey | IBFRNUSPWKNVRR-RDWMDRTOSA-N |
| XLogP | -0.96 |
| TPSA | 190.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.42 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|