C21H31NO14 — CID 11800141
methyl (2S,4S,5R,6R)-4-acetyloxy-5-(ethoxycarbonylamino)-2-hydroxy-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate (PubChem CID 11800141) has the molecular formula C21H31NO14 and a molecular weight of 521.47 g/mol. Its IUPAC name is methyl (2S,4S,5R,6R)-4-acetyloxy-5-(ethoxycarbonylamino)-2-hydroxy-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (2S,4S,5R,6R)-4-acetyloxy-5-(ethoxycarbonylamino)-2-hydroxy-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 11800141 |
| Molecular Formula | C21H31NO14 |
| Molecular Weight | 521.47 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | methyl (2S,4S,5R,6R)-4-acetyloxy-5-(ethoxycarbonylamino)-2-hydroxy-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
| SMILES | CCOC(=O)N[C@H]1[C@H]([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)O[C@](O)(C(=O)OC)C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C21H31NO14/c1-7-31-20(28)22-16-14(33-11(3)24)8-21(29,19(27)30-6)36-18(16)17(35-13(5)26)15(34-12(4)25)9-32-10(2)23/h14-18,29H,7-9H2,1-6H3,(H,22,28)/t14-,15+,16+,17+,18+,21-/m0/s1 |
| InChIKey | DROMUDNYDCLEPC-VCIRBXAFSA-N |
| XLogP | -0.89 |
| TPSA | 199.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.47 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|