C24H38NO16P — CID 102096162
methyl (2R,4S,5R,6R)-5-acetamido-4-acetyloxy-2-diethoxyphosphoryloxy-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate (PubChem CID 102096162) has the molecular formula C24H38NO16P and a molecular weight of 627.53 g/mol. Its IUPAC name is methyl (2R,4S,5R,6R)-5-acetamido-4-acetyloxy-2-diethoxyphosphoryloxy-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (2R,4S,5R,6R)-5-acetamido-4-acetyloxy-2-diethoxyphosphoryloxy-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 102096162 |
| Molecular Formula | C24H38NO16P |
| Molecular Weight | 627.53 g/mol |
| Exact Mass | 627.19 |
| IUPAC Name | methyl (2R,4S,5R,6R)-5-acetamido-4-acetyloxy-2-diethoxyphosphoryloxy-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
| SMILES | CCOP(=O)(OCC)O[C@@]1(C(=O)OC)C[C@H](OC(C)=O)[C@@H](NC(C)=O)[C@H]([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C24H38NO16P/c1-9-35-42(32,36-10-2)41-24(23(31)33-8)11-18(37-15(5)28)20(25-13(3)26)22(40-24)21(39-17(7)30)19(38-16(6)29)12-34-14(4)27/h18-22H,9-12H2,1-8H3,(H,25,26)/t18-,19+,20+,21+,22+,24+/m0/s1 |
| InChIKey | WHCXRUJSAFOFLW-KZXFCMPVSA-N |
| XLogP | 0.71 |
| TPSA | 214.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.53 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|