C23H33NO13 — CID 11295512
methyl (2R,4S,5R,6R)-5-acetamido-4-acetyloxy-2-prop-2-enoxy-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate (PubChem CID 11295512) has the molecular formula C23H33NO13 and a molecular weight of 531.51 g/mol. Its IUPAC name is methyl (2R,4S,5R,6R)-5-acetamido-4-acetyloxy-2-prop-2-enoxy-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (2R,4S,5R,6R)-5-acetamido-4-acetyloxy-2-prop-2-enoxy-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 11295512 |
| Molecular Formula | C23H33NO13 |
| Molecular Weight | 531.51 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | methyl (2R,4S,5R,6R)-5-acetamido-4-acetyloxy-2-prop-2-enoxy-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
| SMILES | C=CCO[C@]1(C(=O)OC)C[C@H](OC(C)=O)[C@@H](NC(C)=O)[C@H]([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C23H33NO13/c1-8-9-33-23(22(30)31-7)10-17(34-14(4)27)19(24-12(2)25)21(37-23)20(36-16(6)29)18(35-15(5)28)11-32-13(3)26/h8,17-21H,1,9-11H2,2-7H3,(H,24,25)/t17-,18+,19+,20+,21+,23+/m0/s1 |
| InChIKey | MDHGVFXEYFQUKV-CFPLAWGXSA-N |
| XLogP | -0.29 |
| TPSA | 179.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.51 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|