C28H44N4O13 — CID 10372000
methyl (2S,4S,5R,6R)-5-acetamido-4-acetyloxy-2-(8-azidooctoxy)-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate (PubChem CID 10372000) has the molecular formula C28H44N4O13 and a molecular weight of 644.67 g/mol. Its IUPAC name is methyl (2S,4S,5R,6R)-5-acetamido-4-acetyloxy-2-(8-azidooctoxy)-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (2S,4S,5R,6R)-5-acetamido-4-acetyloxy-2-(8-azidooctoxy)-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 10372000 |
| Molecular Formula | C28H44N4O13 |
| Molecular Weight | 644.67 g/mol |
| Exact Mass | 644.29 |
| IUPAC Name | methyl (2S,4S,5R,6R)-5-acetamido-4-acetyloxy-2-(8-azidooctoxy)-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
| SMILES | COC(=O)[C@]1(OCCCCCCCCN=[N+]=[N-])C[C@H](OC(C)=O)[C@@H](NC(C)=O)[C@H]([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C28H44N4O13/c1-17(33)31-24-22(42-19(3)35)15-28(27(38)39-6,41-14-12-10-8-7-9-11-13-30-32-29)45-26(24)25(44-21(5)37)23(43-20(4)36)16-40-18(2)34/h22-26H,7-16H2,1-6H3,(H,31,33)/t22-,23+,24+,25+,26+,28-/m0/s1 |
| InChIKey | KXCWHCSANLBEIF-LJXJJVDOSA-N |
| XLogP | 2.17 |
| TPSA | 227.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.67 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|