C23H33NO13S2 — CID 10722214
methyl (2R,4S,5R,6R)-5-acetamido-4-acetyloxy-2-ethoxycarbothioylsulfanyl-6-[(1S)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate (PubChem CID 10722214) has the molecular formula C23H33NO13S2 and a molecular weight of 595.65 g/mol. Its IUPAC name is methyl (2R,4S,5R,6R)-5-acetamido-4-acetyloxy-2-ethoxycarbothioylsulfanyl-6-[(1S)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (2R,4S,5R,6R)-5-acetamido-4-acetyloxy-2-ethoxycarbothioylsulfanyl-6-[(1S)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 10722214 |
| Molecular Formula | C23H33NO13S2 |
| Molecular Weight | 595.65 g/mol |
| Exact Mass | 595.14 |
| IUPAC Name | methyl (2R,4S,5R,6R)-5-acetamido-4-acetyloxy-2-ethoxycarbothioylsulfanyl-6-[(1S)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
| SMILES | CCOC(=S)S[C@@]1(C(=O)OC)C[C@H](OC(C)=O)[C@@H](NC(C)=O)[C@H]([C@H](OC(C)=O)C(COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C23H33NO13S2/c1-8-32-22(38)39-23(21(30)31-7)9-16(34-13(4)27)18(24-11(2)25)20(37-23)19(36-15(6)29)17(35-14(5)28)10-33-12(3)26/h16-20H,8-10H2,1-7H3,(H,24,25)/t16-,17?,18+,19+,20+,23+/m0/s1 |
| InChIKey | FFSWHKBJBFZYLG-DWBNIUHNSA-N |
| XLogP | 0.56 |
| TPSA | 179.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.65 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|