C22H34N2O12 — CID 102076785
methyl (2S,4S,5R,6R)-5-acetamido-2-hydroxy-4-morpholin-4-yl-6-[(1R,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate (PubChem CID 102076785) has the molecular formula C22H34N2O12 and a molecular weight of 518.52 g/mol. Its IUPAC name is methyl (2S,4S,5R,6R)-5-acetamido-2-hydroxy-4-morpholin-4-yl-6-[(1R,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (2S,4S,5R,6R)-5-acetamido-2-hydroxy-4-morpholin-4-yl-6-[(1R,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 102076785 |
| Molecular Formula | C22H34N2O12 |
| Molecular Weight | 518.52 g/mol |
| Exact Mass | 518.21 |
| IUPAC Name | methyl (2S,4S,5R,6R)-5-acetamido-2-hydroxy-4-morpholin-4-yl-6-[(1R,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
| SMILES | COC(=O)[C@]1(O)C[C@H](N2CCOCC2)[C@@H](NC(C)=O)[C@H]([C@@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C22H34N2O12/c1-12(25)23-18-16(24-6-8-32-9-7-24)10-22(30,21(29)31-5)36-20(18)19(35-15(4)28)17(34-14(3)27)11-33-13(2)26/h16-20,30H,6-11H2,1-5H3,(H,23,25)/t16-,17+,18+,19-,20+,22-/m0/s1 |
| InChIKey | AMIOUHZHGIQJLJ-DAKQKNLNSA-N |
| XLogP | -1.73 |
| TPSA | 176.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.52 |
| LogP ≤ 5 | -1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|