C23H36N2O12 — CID 139091053
methyl (2S,4R,5S,6S)-5-acetamido-2-methoxy-4-morpholin-4-yl-6-[(1R,2S)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate (PubChem CID 139091053) has the molecular formula C23H36N2O12 and a molecular weight of 532.54 g/mol. Its IUPAC name is methyl (2S,4R,5S,6S)-5-acetamido-2-methoxy-4-morpholin-4-yl-6-[(1R,2S)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (2S,4R,5S,6S)-5-acetamido-2-methoxy-4-morpholin-4-yl-6-[(1R,2S)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 139091053 |
| Molecular Formula | C23H36N2O12 |
| Molecular Weight | 532.54 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | methyl (2S,4R,5S,6S)-5-acetamido-2-methoxy-4-morpholin-4-yl-6-[(1R,2S)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
| SMILES | COC(=O)[C@]1(OC)C[C@@H](N2CCOCC2)[C@H](NC(C)=O)[C@@H]([C@@H](OC(C)=O)[C@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C23H36N2O12/c1-13(26)24-19-17(25-7-9-33-10-8-25)11-23(32-6,22(30)31-5)37-21(19)20(36-16(4)29)18(35-15(3)28)12-34-14(2)27/h17-21H,7-12H2,1-6H3,(H,24,26)/t17-,18+,19+,20+,21+,23+/m1/s1 |
| InChIKey | DQCCCNUGLGMKLY-JHLACRBESA-N |
| XLogP | -1.08 |
| TPSA | 165.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.54 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|