C20H31NO11 — CID 23240052
methyl (2S,4R,5R,6R)-5-acetamido-2-methoxy-4-methyl-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate (PubChem CID 23240052) has the molecular formula C20H31NO11 and a molecular weight of 461.46 g/mol. Its IUPAC name is methyl (2S,4R,5R,6R)-5-acetamido-2-methoxy-4-methyl-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (2S,4R,5R,6R)-5-acetamido-2-methoxy-4-methyl-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 23240052 |
| Molecular Formula | C20H31NO11 |
| Molecular Weight | 461.46 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | methyl (2S,4R,5R,6R)-5-acetamido-2-methoxy-4-methyl-6-[(1S,2R)-1,2,3-triacetyloxypropyl]oxane-2-carboxylate |
| SMILES | COC(=O)[C@]1(OC)C[C@@H](C)[C@@H](NC(C)=O)[C@H]([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)O1 |
| InChI | InChI=1S/C20H31NO11/c1-10-8-20(28-7,19(26)27-6)32-18(16(10)21-11(2)22)17(31-14(5)25)15(30-13(4)24)9-29-12(3)23/h10,15-18H,8-9H2,1-7H3,(H,21,22)/t10-,15-,16-,17-,18-,20+/m1/s1 |
| InChIKey | MDVQJXKBZRRPSH-WJOUBCLASA-N |
| XLogP | -0.14 |
| TPSA | 152.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.46 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|