C22H31N3O9 — CID 131998158
methyl (2R,3R,4R)-3-methyl-4-(4-propyltriazol-1-yl)-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 131998158) has the molecular formula C22H31N3O9 and a molecular weight of 481.50 g/mol. Its IUPAC name is methyl (2R,3R,4R)-3-methyl-4-(4-propyltriazol-1-yl)-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | methyl (2R,3R,4R)-3-methyl-4-(4-propyltriazol-1-yl)-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 131998158 |
| Molecular Formula | C22H31N3O9 |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | methyl (2R,3R,4R)-3-methyl-4-(4-propyltriazol-1-yl)-2-[(1S,2R)-1,2,3-triacetyloxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | CCCc1cn([C@H]2C=C(C(=O)OC)O[C@@H]([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)[C@@H]2C)nn1 |
| InChI | InChI=1S/C22H31N3O9/c1-7-8-16-10-25(24-23-16)17-9-18(22(29)30-6)34-20(12(17)2)21(33-15(5)28)19(32-14(4)27)11-31-13(3)26/h9-10,12,17,19-21H,7-8,11H2,1-6H3/t12-,17+,19-,20-,21-/m1/s1 |
| InChIKey | JCPWFNYIINGAFZ-IQUYCSQLSA-N |
| XLogP | 1.29 |
| TPSA | 145.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|