C9H12N6O3 — CID 139417088
ethyl (3R)-4,5-diazido-3-hydroxycyclohexene-1-carboxylate (PubChem CID 139417088) has the molecular formula C9H12N6O3 and a molecular weight of 252.23 g/mol. Its IUPAC name is ethyl (3R)-4,5-diazido-3-hydroxycyclohexene-1-carboxylate.
| Compound Name | ethyl (3R)-4,5-diazido-3-hydroxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 139417088 |
| Molecular Formula | C9H12N6O3 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | ethyl (3R)-4,5-diazido-3-hydroxycyclohexene-1-carboxylate |
| SMILES | CCOC(=O)C1=C[C@@H](O)C(N=[N+]=[N-])C(N=[N+]=[N-])C1 |
| InChI | InChI=1S/C9H12N6O3/c1-2-18-9(17)5-3-6(12-14-10)8(13-15-11)7(16)4-5/h4,6-8,16H,2-3H2,1H3/t6?,7-,8?/m1/s1 |
| InChIKey | LNUIZXRMSQTXSA-ZUEIMRROSA-N |
| XLogP | 1.60 |
| TPSA | 144.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|