C10H16N4O3 — CID 53375308
N-[(1R,2S,6S)-6-azido-2-(methoxymethoxy)cyclohex-3-en-1-yl]acetamide (PubChem CID 53375308) has the molecular formula C10H16N4O3 and a molecular weight of 240.26 g/mol. Its IUPAC name is N-[(1R,2S,6S)-6-azido-2-(methoxymethoxy)cyclohex-3-en-1-yl]acetamide.
| Compound Name | N-[(1R,2S,6S)-6-azido-2-(methoxymethoxy)cyclohex-3-en-1-yl]acetamide |
|---|---|
| PubChem CID | 53375308 |
| Molecular Formula | C10H16N4O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | N-[(1R,2S,6S)-6-azido-2-(methoxymethoxy)cyclohex-3-en-1-yl]acetamide |
| SMILES | COCO[C@H]1C=CC[C@H](N=[N+]=[N-])[C@H]1NC(C)=O |
| InChI | InChI=1S/C10H16N4O3/c1-7(15)12-10-8(13-14-11)4-3-5-9(10)17-6-16-2/h3,5,8-10H,4,6H2,1-2H3,(H,12,15)/t8-,9-,10+/m0/s1 |
| InChIKey | KUXLSSYUCAVVOL-LPEHRKFASA-N |
| XLogP | 1.12 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|