C12H20N4O8 — CID 134973404
methyl (2S,4R,5R)-5-acetamido-4-azido-2-hydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate (PubChem CID 134973404) has the molecular formula C12H20N4O8 and a molecular weight of 348.31 g/mol. Its IUPAC name is methyl (2S,4R,5R)-5-acetamido-4-azido-2-hydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (2S,4R,5R)-5-acetamido-4-azido-2-hydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 134973404 |
| Molecular Formula | C12H20N4O8 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | methyl (2S,4R,5R)-5-acetamido-4-azido-2-hydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
| SMILES | COC(=O)[C@]1(O)C[C@@H](N=[N+]=[N-])[C@@H](NC(C)=O)C([C@H](O)[C@H](O)CO)O1 |
| InChI | InChI=1S/C12H20N4O8/c1-5(18)14-8-6(15-16-13)3-12(22,11(21)23-2)24-10(8)9(20)7(19)4-17/h6-10,17,19-20,22H,3-4H2,1-2H3,(H,14,18)/t6-,7-,8-,9-,10?,12+/m1/s1 |
| InChIKey | UIDSTXSOTPEZCN-QRABGUOBSA-N |
| XLogP | -2.47 |
| TPSA | 194.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|