C11H16F2N4O7 — CID 90360377
(2R,3S,5R)-5-acetamido-4-azido-2,3-difluoro-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid (PubChem CID 90360377) has the molecular formula C11H16F2N4O7 and a molecular weight of 354.27 g/mol. Its IUPAC name is (2R,3S,5R)-5-acetamido-4-azido-2,3-difluoro-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid.
| Compound Name | (2R,3S,5R)-5-acetamido-4-azido-2,3-difluoro-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 90360377 |
| Molecular Formula | C11H16F2N4O7 |
| Molecular Weight | 354.27 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | (2R,3S,5R)-5-acetamido-4-azido-2,3-difluoro-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
| SMILES | CC(=O)N[C@H]1C([C@H](O)[C@H](O)CO)O[C@@](F)(C(=O)O)[C@@H](F)C1N=[N+]=[N-] |
| InChI | InChI=1S/C11H16F2N4O7/c1-3(19)15-5-6(16-17-14)9(12)11(13,10(22)23)24-8(5)7(21)4(20)2-18/h4-9,18,20-21H,2H2,1H3,(H,15,19)(H,22,23)/t4-,5-,6?,7-,8?,9+,11-/m1/s1 |
| InChIKey | WALCBWHVMFYBFE-XPAMZJCWSA-N |
| XLogP | -1.63 |
| TPSA | 185.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.27 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|