C12H20F2N4O7 — CID 75576308
5-acetamido-4-(diaminomethylideneamino)-2,3-difluoro-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylic acid (PubChem CID 75576308) has the molecular formula C12H20F2N4O7 and a molecular weight of 370.31 g/mol. Its IUPAC name is 5-acetamido-4-(diaminomethylideneamino)-2,3-difluoro-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylic acid.
| Compound Name | 5-acetamido-4-(diaminomethylideneamino)-2,3-difluoro-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 75576308 |
| Molecular Formula | C12H20F2N4O7 |
| Molecular Weight | 370.31 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 5-acetamido-4-(diaminomethylideneamino)-2,3-difluoro-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylic acid |
| SMILES | CC(=O)NC1C(N=C(N)N)C(F)C(F)(C(=O)O)OC1C(O)C(O)CO |
| InChI | InChI=1S/C12H20F2N4O7/c1-3(20)17-5-6(18-11(15)16)9(13)12(14,10(23)24)25-8(5)7(22)4(21)2-19/h4-9,19,21-22H,2H2,1H3,(H,17,20)(H,23,24)(H4,15,16,18) |
| InChIKey | XFCFNKGCFMUBDK-UHFFFAOYSA-N |
| XLogP | -3.67 |
| TPSA | 200.72 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.31 |
| LogP ≤ 5 | -3.67 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|