C17H27F2N3O8 — CID 146794377
(2R,4S,5R)-6-[(1R,2R)-3-butanoyloxy-1,2-dihydroxypropyl]-4-(diaminomethylideneamino)-2,3-difluoro-5-(2-oxopropyl)oxane-2-carboxylic acid (PubChem CID 146794377) has the molecular formula C17H27F2N3O8 and a molecular weight of 439.41 g/mol. Its IUPAC name is (2R,4S,5R)-6-[(1R,2R)-3-butanoyloxy-1,2-dihydroxypropyl]-4-(diaminomethylideneamino)-2,3-difluoro-5-(2-oxopropyl)oxane-2-carboxylic acid.
| Compound Name | (2R,4S,5R)-6-[(1R,2R)-3-butanoyloxy-1,2-dihydroxypropyl]-4-(diaminomethylideneamino)-2,3-difluoro-5-(2-oxopropyl)oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 146794377 |
| Molecular Formula | C17H27F2N3O8 |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | (2R,4S,5R)-6-[(1R,2R)-3-butanoyloxy-1,2-dihydroxypropyl]-4-(diaminomethylideneamino)-2,3-difluoro-5-(2-oxopropyl)oxane-2-carboxylic acid |
| SMILES | CCCC(=O)OC[C@@H](O)[C@@H](O)C1O[C@@](F)(C(=O)O)C(F)[C@@H](N=C(N)N)[C@H]1CC(C)=O |
| InChI | InChI=1S/C17H27F2N3O8/c1-3-4-10(25)29-6-9(24)12(26)13-8(5-7(2)23)11(22-16(20)21)14(18)17(19,30-13)15(27)28/h8-9,11-14,24,26H,3-6H2,1-2H3,(H,27,28)(H4,20,21,22)/t8-,9-,11+,12-,13?,14?,17-/m1/s1 |
| InChIKey | RWLVACDPNHZVHW-DSGMIWMDSA-N |
| XLogP | -1.22 |
| TPSA | 194.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|