C14H25ClF2N2O6 — CID 161057559
ethyl 4-(1-aminoethylideneamino)-2,3-difluoro-5-methyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate;hydrochloride (PubChem CID 161057559) has the molecular formula C14H25ClF2N2O6 and a molecular weight of 390.81 g/mol. Its IUPAC name is ethyl 4-(1-aminoethylideneamino)-2,3-difluoro-5-methyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate;hydrochloride.
| Compound Name | ethyl 4-(1-aminoethylideneamino)-2,3-difluoro-5-methyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 161057559 |
| Molecular Formula | C14H25ClF2N2O6 |
| Molecular Weight | 390.81 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | ethyl 4-(1-aminoethylideneamino)-2,3-difluoro-5-methyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate;hydrochloride |
| SMILES | CCOC(=O)C1(F)OC([C@H](O)[C@H](O)CO)C(C)C(/N=C(\C)N)C1F.Cl |
| InChI | InChI=1S/C14H24F2N2O6.ClH/c1-4-23-13(22)14(16)12(15)9(18-7(3)17)6(2)11(24-14)10(21)8(20)5-19;/h6,8-12,19-21H,4-5H2,1-3H3,(H2,17,18);1H/t6?,8-,9?,10-,11?,12?,14?;/m1./s1 |
| InChIKey | FDQKFSIWSCTSLG-QCXYVNPTSA-N |
| XLogP | -0.53 |
| TPSA | 134.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.81 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|