C13H23F2N3O6 — CID 118928137
ethyl 5-amino-4-(1-aminoethylideneamino)-2,3-difluoro-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate (PubChem CID 118928137) has the molecular formula C13H23F2N3O6 and a molecular weight of 355.34 g/mol. Its IUPAC name is ethyl 5-amino-4-(1-aminoethylideneamino)-2,3-difluoro-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate.
| Compound Name | ethyl 5-amino-4-(1-aminoethylideneamino)-2,3-difluoro-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 118928137 |
| Molecular Formula | C13H23F2N3O6 |
| Molecular Weight | 355.34 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | ethyl 5-amino-4-(1-aminoethylideneamino)-2,3-difluoro-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
| SMILES | CCOC(=O)C1(F)OC([C@H](O)[C@H](O)CO)C(N)C(/N=C(\C)N)C1F |
| InChI | InChI=1S/C13H23F2N3O6/c1-3-23-12(22)13(15)11(14)8(18-5(2)16)7(17)10(24-13)9(21)6(20)4-19/h6-11,19-21H,3-4,17H2,1-2H3,(H2,16,18)/t6-,7?,8?,9-,10?,11?,13?/m1/s1 |
| InChIKey | RLRAPMZAOSWRGC-LAIYSIDWSA-N |
| XLogP | -2.26 |
| TPSA | 160.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.34 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|