C11H18FNO9 — CID 151039810
(4R,5R,6R)-3-acetyl-5-amino-3-fluoro-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid (PubChem CID 151039810) has the molecular formula C11H18FNO9 and a molecular weight of 327.26 g/mol. Its IUPAC name is (4R,5R,6R)-3-acetyl-5-amino-3-fluoro-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid.
| Compound Name | (4R,5R,6R)-3-acetyl-5-amino-3-fluoro-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 151039810 |
| Molecular Formula | C11H18FNO9 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | (4R,5R,6R)-3-acetyl-5-amino-3-fluoro-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
| SMILES | CC(=O)C1(F)[C@H](O)[C@@H](N)[C@H]([C@H](O)[C@H](O)CO)OC1(O)C(=O)O |
| InChI | InChI=1S/C11H18FNO9/c1-3(15)10(12)8(18)5(13)7(6(17)4(16)2-14)22-11(10,21)9(19)20/h4-8,14,16-18,21H,2,13H2,1H3,(H,19,20)/t4-,5+,6-,7-,8-,10?,11?/m1/s1 |
| InChIKey | MBVOCRCPOYYIDB-LKDCVEAASA-N |
| XLogP | -4.14 |
| TPSA | 190.77 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | -4.14 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |