C9H17NO11S — CID 170312989
(4S,5S,6R)-5-amino-2-hydroxy-4-sulfooxy-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylic acid (PubChem CID 170312989) has the molecular formula C9H17NO11S and a molecular weight of 347.30 g/mol. Its IUPAC name is (4S,5S,6R)-5-amino-2-hydroxy-4-sulfooxy-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylic acid.
| Compound Name | (4S,5S,6R)-5-amino-2-hydroxy-4-sulfooxy-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 170312989 |
| Molecular Formula | C9H17NO11S |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | (4S,5S,6R)-5-amino-2-hydroxy-4-sulfooxy-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylic acid |
| SMILES | N[C@@H]1[C@@H](OS(=O)(=O)O)CC(O)(C(=O)O)O[C@H]1C(O)C(O)CO |
| InChI | InChI=1S/C9H17NO11S/c10-5-4(21-22(17,18)19)1-9(16,8(14)15)20-7(5)6(13)3(12)2-11/h3-7,11-13,16H,1-2,10H2,(H,14,15)(H,17,18,19)/t3?,4-,5+,6?,7+,9?/m0/s1 |
| InChIKey | IAIVMFNUVMMBKE-AINUSJKBSA-N |
| XLogP | -4.22 |
| TPSA | 217.07 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | -4.22 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|