C9H17NO9 — CID 22883445
(2S,4S,5S,6S)-5-amino-2,4,5-trihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid (PubChem CID 22883445) has the molecular formula C9H17NO9 and a molecular weight of 283.23 g/mol. Its IUPAC name is (2S,4S,5S,6S)-5-amino-2,4,5-trihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid.
| Compound Name | (2S,4S,5S,6S)-5-amino-2,4,5-trihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 22883445 |
| Molecular Formula | C9H17NO9 |
| Molecular Weight | 283.23 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | (2S,4S,5S,6S)-5-amino-2,4,5-trihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
| SMILES | N[C@]1(O)[C@@H](O)C[C@@](O)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H17NO9/c10-9(18)4(13)1-8(17,7(15)16)19-6(9)5(14)3(12)2-11/h3-6,11-14,17-18H,1-2,10H2,(H,15,16)/t3-,4+,5-,6+,8+,9+/m1/s1 |
| InChIKey | KBUCREWGAFLDNF-NDWBXLDQSA-N |
| XLogP | -4.73 |
| TPSA | 193.93 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.23 |
| LogP ≤ 5 | -4.73 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|