C9H16N4O8 — CID 18654120
(2S,4S,5S,6R)-5-amino-5-azido-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid (PubChem CID 18654120) has the molecular formula C9H16N4O8 and a molecular weight of 308.25 g/mol. Its IUPAC name is (2S,4S,5S,6R)-5-amino-5-azido-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid.
| Compound Name | (2S,4S,5S,6R)-5-amino-5-azido-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 18654120 |
| Molecular Formula | C9H16N4O8 |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | (2S,4S,5S,6R)-5-amino-5-azido-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
| SMILES | [N-]=[N+]=N[C@@]1(N)[C@@H](O)C[C@@](O)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H16N4O8/c10-9(12-13-11)4(16)1-8(20,7(18)19)21-6(9)5(17)3(15)2-14/h3-6,14-17,20H,1-2,10H2,(H,18,19)/t3-,4+,5-,6+,8+,9+/m1/s1 |
| InChIKey | AKEBBUOSMMGFQJ-NDWBXLDQSA-N |
| XLogP | -3.41 |
| TPSA | 222.46 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | -3.41 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|