C9H19N3O8 — CID 140976169
(4S,6R)-4,5,5-triamino-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid (PubChem CID 140976169) has the molecular formula C9H19N3O8 and a molecular weight of 297.26 g/mol. Its IUPAC name is (4S,6R)-4,5,5-triamino-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid.
| Compound Name | (4S,6R)-4,5,5-triamino-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 140976169 |
| Molecular Formula | C9H19N3O8 |
| Molecular Weight | 297.26 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | (4S,6R)-4,5,5-triamino-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
| SMILES | NC1(N)[C@H]([C@H](O)[C@H](O)CO)OC(O)(C(=O)O)C[C@]1(N)O |
| InChI | InChI=1S/C9H19N3O8/c10-8(19)2-7(18,6(16)17)20-5(9(8,11)12)4(15)3(14)1-13/h3-5,13-15,18-19H,1-2,10-12H2,(H,16,17)/t3-,4-,5+,7?,8+/m1/s1 |
| InChIKey | FMOBRYCNNFPDLL-GZSJKVLASA-N |
| XLogP | -5.48 |
| TPSA | 225.74 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.26 |
| LogP ≤ 5 | -5.48 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|