C11H21N3O9 — CID 90105135
(2S,4S,5S,6R)-5-amino-5-[(2-aminoacetyl)amino]-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid (PubChem CID 90105135) has the molecular formula C11H21N3O9 and a molecular weight of 339.30 g/mol. Its IUPAC name is (2S,4S,5S,6R)-5-amino-5-[(2-aminoacetyl)amino]-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid.
| Compound Name | (2S,4S,5S,6R)-5-amino-5-[(2-aminoacetyl)amino]-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 90105135 |
| Molecular Formula | C11H21N3O9 |
| Molecular Weight | 339.30 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | (2S,4S,5S,6R)-5-amino-5-[(2-aminoacetyl)amino]-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
| SMILES | NCC(=O)N[C@@]1(N)[C@@H](O)C[C@@](O)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C11H21N3O9/c12-2-6(18)14-11(13)5(17)1-10(22,9(20)21)23-8(11)7(19)4(16)3-15/h4-5,7-8,15-17,19,22H,1-3,12-13H2,(H,14,18)(H,20,21)/t4-,5+,7-,8+,10+,11+/m1/s1 |
| InChIKey | JYXPGAGDNGROEU-RTCVBHHNSA-N |
| XLogP | -5.65 |
| TPSA | 228.82 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.30 |
| LogP ≤ 5 | -5.65 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|