C11H19NO10 — CID 22880774
(2S,4S,5R,6R)-5-amino-2,4-dihydroxy-5-(2-hydroxyacetyl)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid (PubChem CID 22880774) has the molecular formula C11H19NO10 and a molecular weight of 325.27 g/mol. Its IUPAC name is (2S,4S,5R,6R)-5-amino-2,4-dihydroxy-5-(2-hydroxyacetyl)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid.
| Compound Name | (2S,4S,5R,6R)-5-amino-2,4-dihydroxy-5-(2-hydroxyacetyl)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 22880774 |
| Molecular Formula | C11H19NO10 |
| Molecular Weight | 325.27 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | (2S,4S,5R,6R)-5-amino-2,4-dihydroxy-5-(2-hydroxyacetyl)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
| SMILES | N[C@]1(C(=O)CO)[C@@H](O)C[C@@](O)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C11H19NO10/c12-11(6(17)3-14)5(16)1-10(21,9(19)20)22-8(11)7(18)4(15)2-13/h4-5,7-8,13-16,18,21H,1-3,12H2,(H,19,20)/t4-,5+,7-,8+,10+,11+/m1/s1 |
| InChIKey | LHZGINQTXBBMKG-RTCVBHHNSA-N |
| XLogP | -5.12 |
| TPSA | 211.00 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.27 |
| LogP ≤ 5 | -5.12 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |