C15H28N2O9 — CID 67882968
(2S,4S,5R,6R)-5-(6-aminohexanoylamino)-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid (PubChem CID 67882968) has the molecular formula C15H28N2O9 and a molecular weight of 380.39 g/mol. Its IUPAC name is (2S,4S,5R,6R)-5-(6-aminohexanoylamino)-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid.
| Compound Name | (2S,4S,5R,6R)-5-(6-aminohexanoylamino)-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 67882968 |
| Molecular Formula | C15H28N2O9 |
| Molecular Weight | 380.39 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | (2S,4S,5R,6R)-5-(6-aminohexanoylamino)-2,4-dihydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
| SMILES | NCCCCCC(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CO)O[C@](O)(C(=O)O)C[C@@H]1O |
| InChI | InChI=1S/C15H28N2O9/c16-5-3-1-2-4-10(21)17-11-8(19)6-15(25,14(23)24)26-13(11)12(22)9(20)7-18/h8-9,11-13,18-20,22,25H,1-7,16H2,(H,17,21)(H,23,24)/t8-,9+,11+,12+,13+,15-/m0/s1 |
| InChIKey | VOATVDAOAWCXSU-BTIXGSHYSA-N |
| XLogP | -3.37 |
| TPSA | 202.80 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.39 |
| LogP ≤ 5 | -3.37 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|