C15H27NO9 — CID 141373871
methyl (4S,5R,6R)-5-amino-2,4-dihydroxy-3-pentanoyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate (PubChem CID 141373871) has the molecular formula C15H27NO9 and a molecular weight of 365.38 g/mol. Its IUPAC name is methyl (4S,5R,6R)-5-amino-2,4-dihydroxy-3-pentanoyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (4S,5R,6R)-5-amino-2,4-dihydroxy-3-pentanoyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 141373871 |
| Molecular Formula | C15H27NO9 |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | methyl (4S,5R,6R)-5-amino-2,4-dihydroxy-3-pentanoyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
| SMILES | CCCCC(=O)C1[C@H](O)[C@@H](N)[C@H]([C@H](O)[C@H](O)CO)OC1(O)C(=O)OC |
| InChI | InChI=1S/C15H27NO9/c1-3-4-5-7(18)9-12(21)10(16)13(11(20)8(19)6-17)25-15(9,23)14(22)24-2/h8-13,17,19-21,23H,3-6,16H2,1-2H3/t8-,9?,10-,11-,12+,13-,15?/m1/s1 |
| InChIKey | WSZZEPYAFYDKHD-WDSFBTLOSA-N |
| XLogP | -2.98 |
| TPSA | 179.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | -2.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |