C14H26N2O9 — CID 139783846
(2R,4S,5R,6R)-5-acetamido-3-(1-aminopropyl)-2,4-dihydroxy-6-[(2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid (PubChem CID 139783846) has the molecular formula C14H26N2O9 and a molecular weight of 366.37 g/mol. Its IUPAC name is (2R,4S,5R,6R)-5-acetamido-3-(1-aminopropyl)-2,4-dihydroxy-6-[(2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid.
| Compound Name | (2R,4S,5R,6R)-5-acetamido-3-(1-aminopropyl)-2,4-dihydroxy-6-[(2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 139783846 |
| Molecular Formula | C14H26N2O9 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | (2R,4S,5R,6R)-5-acetamido-3-(1-aminopropyl)-2,4-dihydroxy-6-[(2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
| SMILES | CCC(N)C1[C@H](O)[C@@H](NC(C)=O)[C@H](C(O)[C@H](O)CO)O[C@@]1(O)C(=O)O |
| InChI | InChI=1S/C14H26N2O9/c1-3-6(15)8-11(21)9(16-5(2)18)12(10(20)7(19)4-17)25-14(8,24)13(22)23/h6-12,17,19-21,24H,3-4,15H2,1-2H3,(H,16,18)(H,22,23)/t6?,7-,8?,9-,10?,11+,12-,14-/m1/s1 |
| InChIKey | KCGAWOBPNAYUSG-MYHONSPWSA-N |
| XLogP | -3.91 |
| TPSA | 202.80 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | -3.91 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |