C17H31NO8S — CID 10573570
(2S,4S,5R,6R)-5-acetamido-2-(2-ethylbutylsulfanyl)-4-hydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid (PubChem CID 10573570) has the molecular formula C17H31NO8S and a molecular weight of 409.50 g/mol. Its IUPAC name is (2S,4S,5R,6R)-5-acetamido-2-(2-ethylbutylsulfanyl)-4-hydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid.
| Compound Name | (2S,4S,5R,6R)-5-acetamido-2-(2-ethylbutylsulfanyl)-4-hydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 10573570 |
| Molecular Formula | C17H31NO8S |
| Molecular Weight | 409.50 g/mol |
| Exact Mass | 409.18 |
| IUPAC Name | (2S,4S,5R,6R)-5-acetamido-2-(2-ethylbutylsulfanyl)-4-hydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
| SMILES | CCC(CC)CS[C@]1(C(=O)O)C[C@H](O)[C@@H](NC(C)=O)[C@H]([C@H](O)[C@H](O)CO)O1 |
| InChI | InChI=1S/C17H31NO8S/c1-4-10(5-2)8-27-17(16(24)25)6-11(21)13(18-9(3)20)15(26-17)14(23)12(22)7-19/h10-15,19,21-23H,4-8H2,1-3H3,(H,18,20)(H,24,25)/t11-,12+,13+,14+,15+,17-/m0/s1 |
| InChIKey | ZEBYWIGCQOJQLH-CXECBNLGSA-N |
| XLogP | -0.69 |
| TPSA | 156.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.50 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |