C17H26N2O8S — CID 10811947
azanium (2S,4S,5R,6R)-5-acetamido-4-hydroxy-2-phenylsulfanyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate (PubChem CID 10811947) has the molecular formula C17H26N2O8S and a molecular weight of 418.47 g/mol. Its IUPAC name is azanium (2S,4S,5R,6R)-5-acetamido-4-hydroxy-2-phenylsulfanyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate.
| Compound Name | azanium (2S,4S,5R,6R)-5-acetamido-4-hydroxy-2-phenylsulfanyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 10811947 |
| Molecular Formula | C17H26N2O8S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | azanium (2S,4S,5R,6R)-5-acetamido-4-hydroxy-2-phenylsulfanyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
| SMILES | CC(=O)N[C@H]1[C@H]([C@H](O)[C@H](O)CO)O[C@@](Sc2ccccc2)(C(=O)[O-])C[C@@H]1O.[NH4+] |
| InChI | InChI=1S/C17H23NO8S.H3N/c1-9(20)18-13-11(21)7-17(16(24)25,27-10-5-3-2-4-6-10)26-15(13)14(23)12(22)8-19;/h2-6,11-15,19,21-23H,7-8H2,1H3,(H,18,20)(H,24,25);1H3/t11-,12+,13+,14+,15+,17-;/m0./s1 |
| InChIKey | BOYFFVGANZUDPD-LKGQIXOTSA-N |
| XLogP | -2.03 |
| TPSA | 195.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |