C13H21NO11 — CID 10690306
(2R,3R,4R,5R,6R)-5-acetamido-3,4-dihydroxy-2-(2-oxoethoxy)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid (PubChem CID 10690306) has the molecular formula C13H21NO11 and a molecular weight of 367.31 g/mol. Its IUPAC name is (2R,3R,4R,5R,6R)-5-acetamido-3,4-dihydroxy-2-(2-oxoethoxy)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid.
| Compound Name | (2R,3R,4R,5R,6R)-5-acetamido-3,4-dihydroxy-2-(2-oxoethoxy)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 10690306 |
| Molecular Formula | C13H21NO11 |
| Molecular Weight | 367.31 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | (2R,3R,4R,5R,6R)-5-acetamido-3,4-dihydroxy-2-(2-oxoethoxy)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
| SMILES | CC(=O)N[C@@H]1[C@@H](O)[C@@H](O)[C@](OCC=O)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C13H21NO11/c1-5(17)14-7-9(20)11(21)13(12(22)23,24-3-2-15)25-10(7)8(19)6(18)4-16/h2,6-11,16,18-21H,3-4H2,1H3,(H,14,17)(H,22,23)/t6-,7-,8-,9-,10-,11-,13-/m1/s1 |
| InChIKey | BHSYDYKAZWPSIQ-MENWFVNHSA-N |
| XLogP | -4.68 |
| TPSA | 203.08 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.31 |
| LogP ≤ 5 | -4.68 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|