C11H17FNO11S- — CID 118487179
[(2S,3S,5R)-5-acetamido-2-carboxy-3-fluoro-4-hydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxan-2-yl] sulfite (PubChem CID 118487179) has the molecular formula C11H17FNO11S- and a molecular weight of 390.32 g/mol. Its IUPAC name is [(2S,3S,5R)-5-acetamido-2-carboxy-3-fluoro-4-hydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxan-2-yl] sulfite.
| Compound Name | [(2S,3S,5R)-5-acetamido-2-carboxy-3-fluoro-4-hydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxan-2-yl] sulfite |
|---|---|
| PubChem CID | 118487179 |
| Molecular Formula | C11H17FNO11S- |
| Molecular Weight | 390.32 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | [(2S,3S,5R)-5-acetamido-2-carboxy-3-fluoro-4-hydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxan-2-yl] sulfite |
| SMILES | CC(=O)N[C@H]1C([C@H](O)[C@H](O)CO)O[C@](OS(=O)[O-])(C(=O)O)[C@@H](F)C1O |
| InChI | InChI=1S/C11H18FNO11S/c1-3(15)13-5-7(18)9(12)11(10(19)20,24-25(21)22)23-8(5)6(17)4(16)2-14/h4-9,14,16-18H,2H2,1H3,(H,13,15)(H,19,20)(H,21,22)/p-1/t4-,5-,6-,7?,8?,9+,11-/m1/s1 |
| InChIKey | DEZHYWHJGOGYTJ-PGRFUPHRSA-M |
| XLogP | -4.11 |
| TPSA | 205.91 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.32 |
| LogP ≤ 5 | -4.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|