C12H19Br2NO8 — CID 134937101
methyl (2S,3S,4R,5R,6R)-5-acetamido-2,3-dibromo-4-hydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate (PubChem CID 134937101) has the molecular formula C12H19Br2NO8 and a molecular weight of 465.09 g/mol. Its IUPAC name is methyl (2S,3S,4R,5R,6R)-5-acetamido-2,3-dibromo-4-hydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4R,5R,6R)-5-acetamido-2,3-dibromo-4-hydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 134937101 |
| Molecular Formula | C12H19Br2NO8 |
| Molecular Weight | 465.09 g/mol |
| Exact Mass | 462.95 |
| IUPAC Name | methyl (2S,3S,4R,5R,6R)-5-acetamido-2,3-dibromo-4-hydroxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
| SMILES | COC(=O)[C@@]1(Br)O[C@@H]([C@H](O)[C@H](O)CO)[C@H](NC(C)=O)[C@@H](O)[C@@H]1Br |
| InChI | InChI=1S/C12H19Br2NO8/c1-4(17)15-6-8(20)10(13)12(14,11(21)22-2)23-9(6)7(19)5(18)3-16/h5-10,16,18-20H,3H2,1-2H3,(H,15,17)/t5-,6-,7-,8-,9-,10+,12+/m1/s1 |
| InChIKey | NORBADLYLQWXHJ-LLXLWUBISA-N |
| XLogP | -2.01 |
| TPSA | 145.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.09 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|