C15H25NO9 — CID 174895068
methyl (4S,5R,6R)-5-acetamido-2,4-dihydroxy-3-propan-2-ylidene-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylate (PubChem CID 174895068) has the molecular formula C15H25NO9 and a molecular weight of 363.36 g/mol. Its IUPAC name is methyl (4S,5R,6R)-5-acetamido-2,4-dihydroxy-3-propan-2-ylidene-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylate.
| Compound Name | methyl (4S,5R,6R)-5-acetamido-2,4-dihydroxy-3-propan-2-ylidene-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylate |
|---|---|
| PubChem CID | 174895068 |
| Molecular Formula | C15H25NO9 |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | methyl (4S,5R,6R)-5-acetamido-2,4-dihydroxy-3-propan-2-ylidene-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylate |
| SMILES | COC(=O)C1(O)O[C@@H](C(O)C(O)CO)[C@H](NC(C)=O)[C@@H](O)C1=C(C)C |
| InChI | InChI=1S/C15H25NO9/c1-6(2)9-12(21)10(16-7(3)18)13(11(20)8(19)5-17)25-15(9,23)14(22)24-4/h8,10-13,17,19-21,23H,5H2,1-4H3,(H,16,18)/t8?,10-,11?,12+,13-,15?/m1/s1 |
| InChIKey | APVIBIKGZBOSJV-RSIOPFLYSA-N |
| XLogP | -2.84 |
| TPSA | 165.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | -2.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|