C11H19FO10S — CID 91253229
3-fluoro-4-hydroxy-5-methyl-2-methylsulfonyloxy-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylic acid (PubChem CID 91253229) has the molecular formula C11H19FO10S and a molecular weight of 362.33 g/mol. Its IUPAC name is 3-fluoro-4-hydroxy-5-methyl-2-methylsulfonyloxy-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylic acid.
| Compound Name | 3-fluoro-4-hydroxy-5-methyl-2-methylsulfonyloxy-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 91253229 |
| Molecular Formula | C11H19FO10S |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 3-fluoro-4-hydroxy-5-methyl-2-methylsulfonyloxy-6-(1,2,3-trihydroxypropyl)oxane-2-carboxylic acid |
| SMILES | CC1C(O)C(F)C(OS(C)(=O)=O)(C(=O)O)OC1C(O)C(O)CO |
| InChI | InChI=1S/C11H19FO10S/c1-4-6(15)9(12)11(10(17)18,22-23(2,19)20)21-8(4)7(16)5(14)3-13/h4-9,13-16H,3H2,1-2H3,(H,17,18) |
| InChIKey | FLALJEUDGBVYLF-UHFFFAOYSA-N |
| XLogP | -2.81 |
| TPSA | 170.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|